C15H24N3ORf- — CID 155695018
ethane;(1E)-1-(3-ethenyl-6,7,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-id-4-yl)buta-1,3-dien-2-amine;rutherfordium (PubChem CID 155695018) has the molecular formula C15H24N3ORf- and a molecular weight of 529.38 g/mol. Its IUPAC name is ethane;(1E)-1-(3-ethenyl-6,7,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-id-4-yl)buta-1,3-dien-2-amine;rutherfordium.
| Compound Name | ethane;(1E)-1-(3-ethenyl-6,7,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-id-4-yl)buta-1,3-dien-2-amine;rutherfordium |
|---|---|
| PubChem CID | 155695018 |
| Molecular Formula | C15H24N3ORf- |
| Molecular Weight | 529.38 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | ethane;(1E)-1-(3-ethenyl-6,7,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-id-4-yl)buta-1,3-dien-2-amine;rutherfordium |
| SMILES | C=CC1=C(/C=C(/N)C=C)N2CC[N-]CC2CO1.CC.[Rf] |
| InChI | InChI=1S/C13H18N3O.C2H6.Rf/c1-3-10(14)7-12-13(4-2)17-9-11-8-15-5-6-16(11)12;1-2;/h3-4,7,11H,1-2,5-6,8-9,14H2;1-2H3;/q-1;;/b10-7+;; |
| InChIKey | XSTGNFIDBLDHHC-WRQJSNHTSA-N |
| XLogP | 2.53 |
| TPSA | 52.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|