C13H19N3O — CID 155695019
(1E)-1-(3-ethenyl-1,6,7,8,9,9a-hexahydropyrazino[2,1-c][1,4]oxazin-4-yl)buta-1,3-dien-2-amine (PubChem CID 155695019) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is (1E)-1-(3-ethenyl-1,6,7,8,9,9a-hexahydropyrazino[2,1-c][1,4]oxazin-4-yl)buta-1,3-dien-2-amine.
| Compound Name | (1E)-1-(3-ethenyl-1,6,7,8,9,9a-hexahydropyrazino[2,1-c][1,4]oxazin-4-yl)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 155695019 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (1E)-1-(3-ethenyl-1,6,7,8,9,9a-hexahydropyrazino[2,1-c][1,4]oxazin-4-yl)buta-1,3-dien-2-amine |
| SMILES | C=CC1=C(/C=C(/N)C=C)N2CCNCC2CO1 |
| InChI | InChI=1S/C13H19N3O/c1-3-10(14)7-12-13(4-2)17-9-11-8-15-5-6-16(11)12/h3-4,7,11,15H,1-2,5-6,8-9,14H2/b10-7+ |
| InChIKey | XFYMPQWPIAYJEK-JXMROGBWSA-N |
| XLogP | 0.72 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|