About 2-phenyl-3-propoxyphenol
2-phenyl-3-propoxyphenol (PubChem CID 155695054) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-phenyl-3-propoxyphenol.
Molecular Properties
| Compound Name | 2-phenyl-3-propoxyphenol |
| PubChem CID | 155695054 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 2-phenyl-3-propoxyphenol |
| SMILES | CCCOc1cccc(O)c1-c1ccccc1 |
| InChI | InChI=1S/C15H16O2/c1-2-11-17-14-10-6-9-13(16)15(14)12-7-4-3-5-8-12/h3-10,16H,2,11H2,1H3 |
| InChIKey | CNPNEIUKSFKWEO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-3-propoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3-propoxyphenol?
The IUPAC name of 2-phenyl-3-propoxyphenol (CID 155695054) is 2-phenyl-3-propoxyphenol.
What is the SMILES notation for 2-phenyl-3-propoxyphenol?
The canonical SMILES for 2-phenyl-3-propoxyphenol is CCCOc1cccc(O)c1-c1ccccc1.
What is the InChIKey of 2-phenyl-3-propoxyphenol?
The InChIKey is CNPNEIUKSFKWEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2/c1-2-11-17-14-10-6-9-13(16)15(14)12-7-4-3-5-8-12/h3-10,16H,2,11H2,1H3.
What are the key properties of 2-phenyl-3-propoxyphenol?
2-phenyl-3-propoxyphenol has a molecular weight of 228.29 g/mol, XLogP of 3.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3-propoxyphenol is sourced from PubChem (CID 155695054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).