About N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide
N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide (PubChem CID 155696644) has the molecular formula C15H29N3
and a molecular weight of 251.42 g/mol. Its IUPAC name is N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide |
| PubChem CID | 155696644 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide |
| SMILES | C=C(/C=C(\C)N/C(C)=N/C)CCCCCN(C)C |
| InChI | InChI=1S/C15H29N3/c1-13(10-8-7-9-11-18(5)6)12-14(2)17-15(3)16-4/h12H,1,7-11H2,2-6H3,(H,16,17)/b14-12+ |
| InChIKey | ISJBKVQKWTWRLW-WYMLVPIESA-N |
| XLogP | 3.21 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide?
The IUPAC name of N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide (CID 155696644) is N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide.
What is the SMILES notation for N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide?
The canonical SMILES for N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide is C=C(/C=C(\C)N/C(C)=N/C)CCCCCN(C)C.
What is the InChIKey of N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide?
The InChIKey is ISJBKVQKWTWRLW-WYMLVPIESA-N. The full InChI is InChI=1S/C15H29N3/c1-13(10-8-7-9-11-18(5)6)12-14(2)17-15(3)16-4/h12H,1,7-11H2,2-6H3,(H,16,17)/b14-12+.
What are the key properties of N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide?
N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide has a molecular weight of 251.42 g/mol, XLogP of 3.21, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide is sourced from PubChem (CID 155696644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).