C25H34N2O2S — CID 155696987
N-[4-[4-(3-ethyl-1-methyl-5-propylcyclohexyl)phenyl]sulfinamoylphenyl]formamide (PubChem CID 155696987) has the molecular formula C25H34N2O2S and a molecular weight of 426.63 g/mol. Its IUPAC name is N-[4-[4-(3-ethyl-1-methyl-5-propylcyclohexyl)phenyl]sulfinamoylphenyl]formamide.
| Compound Name | N-[4-[4-(3-ethyl-1-methyl-5-propylcyclohexyl)phenyl]sulfinamoylphenyl]formamide |
|---|---|
| PubChem CID | 155696987 |
| Molecular Formula | C25H34N2O2S |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-[4-[4-(3-ethyl-1-methyl-5-propylcyclohexyl)phenyl]sulfinamoylphenyl]formamide |
| SMILES | CCCC1CC(CC)CC(C)(c2ccc(NS(=O)c3ccc(NC=O)cc3)cc2)C1 |
| InChI | InChI=1S/C25H34N2O2S/c1-4-6-20-15-19(5-2)16-25(3,17-20)21-7-9-23(10-8-21)27-30(29)24-13-11-22(12-14-24)26-18-28/h7-14,18-20,27H,4-6,15-17H2,1-3H3,(H,26,28) |
| InChIKey | FTCCFYIKGRGJSW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|