C33H42ClN3O4 — CID 155697073
1-O-tert-butyl 3-O-ethyl 4-[4-[2-chloro-4-(1-tricyclo[3.3.1.03,7]nonanyl)anilino]anilino]pyrrolidine-1,3-dicarboxylate (PubChem CID 155697073) has the molecular formula C33H42ClN3O4 and a molecular weight of 580.17 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 4-[4-[2-chloro-4-(1-tricyclo[3.3.1.03,7]nonanyl)anilino]anilino]pyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 4-[4-[2-chloro-4-(1-tricyclo[3.3.1.03,7]nonanyl)anilino]anilino]pyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 155697073 |
| Molecular Formula | C33H42ClN3O4 |
| Molecular Weight | 580.17 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 4-[4-[2-chloro-4-(1-tricyclo[3.3.1.03,7]nonanyl)anilino]anilino]pyrrolidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)OC(C)(C)C)CC1Nc1ccc(Nc2ccc(C34CC5CC(C3)C(C5)C4)cc2Cl)cc1 |
| InChI | InChI=1S/C33H42ClN3O4/c1-5-40-30(38)26-18-37(31(39)41-32(2,3)4)19-29(26)36-25-9-7-24(8-10-25)35-28-11-6-23(14-27(28)34)33-15-20-12-21(16-33)22(13-20)17-33/h6-11,14,20-22,26,29,35-36H,5,12-13,15-19H2,1-4H3 |
| InChIKey | RMCFFHJVFPMTRN-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.17 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|