C34H49ClN2 — CID 155697107
4-N-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-1-N-(2-prop-1-en-2-ylcyclohexyl)benzene-1,4-diamine;ethane (PubChem CID 155697107) has the molecular formula C34H49ClN2 and a molecular weight of 521.23 g/mol. Its IUPAC name is 4-N-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-1-N-(2-prop-1-en-2-ylcyclohexyl)benzene-1,4-diamine;ethane.
| Compound Name | 4-N-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-1-N-(2-prop-1-en-2-ylcyclohexyl)benzene-1,4-diamine;ethane |
|---|---|
| PubChem CID | 155697107 |
| Molecular Formula | C34H49ClN2 |
| Molecular Weight | 521.23 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | 4-N-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-1-N-(2-prop-1-en-2-ylcyclohexyl)benzene-1,4-diamine;ethane |
| SMILES | C=C(C)C1CCCCC1Nc1ccc(Nc2ccc(C3(C)CC4CC(C)CC(C4)C3)cc2Cl)cc1.CC |
| InChI | InChI=1S/C32H43ClN2.C2H6/c1-21(2)28-7-5-6-8-30(28)34-26-10-12-27(13-11-26)35-31-14-9-25(18-29(31)33)32(4)19-23-15-22(3)16-24(17-23)20-32;1-2/h9-14,18,22-24,28,30,34-35H,1,5-8,15-17,19-20H2,2-4H3;1-2H3 |
| InChIKey | XWCXLBONNJBMRK-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.23 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|