C29H34ClF3N2O2 — CID 155697118
2-[3-[2-chloro-4-(2,5-dimethyl-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)anilino]-5-(trifluoromethyl)anilino]cyclopentane-1-carboxylic acid (PubChem CID 155697118) has the molecular formula C29H34ClF3N2O2 and a molecular weight of 535.05 g/mol. Its IUPAC name is 2-[3-[2-chloro-4-(2,5-dimethyl-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)anilino]-5-(trifluoromethyl)anilino]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[3-[2-chloro-4-(2,5-dimethyl-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)anilino]-5-(trifluoromethyl)anilino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 155697118 |
| Molecular Formula | C29H34ClF3N2O2 |
| Molecular Weight | 535.05 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 2-[3-[2-chloro-4-(2,5-dimethyl-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)anilino]-5-(trifluoromethyl)anilino]cyclopentane-1-carboxylic acid |
| SMILES | CC1CC2CC(C)CC2(c2ccc(Nc3cc(NC4CCCC4C(=O)O)cc(C(F)(F)F)c3)c(Cl)c2)C1 |
| InChI | InChI=1S/C29H34ClF3N2O2/c1-16-8-19-9-17(2)15-28(19,14-16)18-6-7-26(24(30)12-18)35-22-11-20(29(31,32)33)10-21(13-22)34-25-5-3-4-23(25)27(36)37/h6-7,10-13,16-17,19,23,25,34-35H,3-5,8-9,14-15H2,1-2H3,(H,36,37) |
| InChIKey | LKEZJSJVNFAPEZ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.05 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |