About 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid
2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid (PubChem CID 155697158) has the molecular formula C26H30ClN3O2
and a molecular weight of 452.00 g/mol. Its IUPAC name is 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid |
| PubChem CID | 155697158 |
| Molecular Formula | C26H30ClN3O2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid |
| SMILES | CC1CC2CC(C1)CC(C)(c1ccc(Nc3ccc4cnn(CC(=O)O)c4c3)c(Cl)c1)C2 |
| InChI | InChI=1S/C26H30ClN3O2/c1-16-7-17-9-18(8-16)13-26(2,12-17)20-4-6-23(22(27)10-20)29-21-5-3-19-14-28-30(15-25(31)32)24(19)11-21/h3-6,10-11,14,16-18,29H,7-9,12-13,15H2,1-2H3,(H,31,32) |
| InChIKey | DUOFXMWMRGLGJN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid?
The IUPAC name of 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid (CID 155697158) is 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid.
What is the SMILES notation for 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid?
The canonical SMILES for 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid is CC1CC2CC(C1)CC(C)(c1ccc(Nc3ccc4cnn(CC(=O)O)c4c3)c(Cl)c1)C2.
What is the InChIKey of 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid?
The InChIKey is DUOFXMWMRGLGJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30ClN3O2/c1-16-7-17-9-18(8-16)13-26(2,12-17)20-4-6-23(22(27)10-20)29-21-5-3-19-14-28-30(15-25(31)32)24(19)11-21/h3-6,10-11,14,16-18,29H,7-9,12-13,15H2,1-2H3,(H,31,32).
What are the key properties of 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid?
2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid has a molecular weight of 452.00 g/mol, XLogP of 6.62, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]indazol-1-yl]acetic acid is sourced from PubChem (CID 155697158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).