C22H34ClN — CID 155697292
2-chloro-4-(3,5-dimethyl-1-adamantyl)-N-ethylaniline;ethane (PubChem CID 155697292) has the molecular formula C22H34ClN and a molecular weight of 347.97 g/mol. Its IUPAC name is 2-chloro-4-(3,5-dimethyl-1-adamantyl)-N-ethylaniline;ethane.
| Compound Name | 2-chloro-4-(3,5-dimethyl-1-adamantyl)-N-ethylaniline;ethane |
|---|---|
| PubChem CID | 155697292 |
| Molecular Formula | C22H34ClN |
| Molecular Weight | 347.97 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 2-chloro-4-(3,5-dimethyl-1-adamantyl)-N-ethylaniline;ethane |
| SMILES | CC.CCNc1ccc(C23CC4CC(C)(CC(C)(C4)C2)C3)cc1Cl |
| InChI | InChI=1S/C20H28ClN.C2H6/c1-4-22-17-6-5-15(7-16(17)21)20-10-14-8-18(2,12-20)11-19(3,9-14)13-20;1-2/h5-7,14,22H,4,8-13H2,1-3H3;1-2H3 |
| InChIKey | VUMYNMMFCNAMCR-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.97 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |