C16H24 — CID 155697638
2-ethyl-1-methyl-4-[(3S)-5-methylhex-5-en-3-yl]benzene (PubChem CID 155697638) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-ethyl-1-methyl-4-[(3S)-5-methylhex-5-en-3-yl]benzene.
| Compound Name | 2-ethyl-1-methyl-4-[(3S)-5-methylhex-5-en-3-yl]benzene |
|---|---|
| PubChem CID | 155697638 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2-ethyl-1-methyl-4-[(3S)-5-methylhex-5-en-3-yl]benzene |
| SMILES | C=C(C)C[C@H](CC)c1ccc(C)c(CC)c1 |
| InChI | InChI=1S/C16H24/c1-6-14-11-16(9-8-13(14)5)15(7-2)10-12(3)4/h8-9,11,15H,3,6-7,10H2,1-2,4-5H3/t15-/m0/s1 |
| InChIKey | HDKDKKYHKCDPHP-HNNXBMFYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|