About 10-hydroxyhexadecanoic acid
10-hydroxyhexadecanoic acid (PubChem CID 15569771) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is 10-hydroxyhexadecanoic acid.
Molecular Properties
| Compound Name | 10-hydroxyhexadecanoic acid |
| PubChem CID | 15569771 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 10-hydroxyhexadecanoic acid |
| SMILES | CCCCCCC(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H32O3/c1-2-3-4-9-12-15(17)13-10-7-5-6-8-11-14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19) |
| InChIKey | QUFMVAWAOYDYFV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-hydroxyhexadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-hydroxyhexadecanoic acid?
The IUPAC name of 10-hydroxyhexadecanoic acid (CID 15569771) is 10-hydroxyhexadecanoic acid.
What is the SMILES notation for 10-hydroxyhexadecanoic acid?
The canonical SMILES for 10-hydroxyhexadecanoic acid is CCCCCCC(O)CCCCCCCCC(=O)O.
What is the InChIKey of 10-hydroxyhexadecanoic acid?
The InChIKey is QUFMVAWAOYDYFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3/c1-2-3-4-9-12-15(17)13-10-7-5-6-8-11-14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19).
What are the key properties of 10-hydroxyhexadecanoic acid?
10-hydroxyhexadecanoic acid has a molecular weight of 272.43 g/mol, XLogP of 4.52, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-hydroxyhexadecanoic acid is sourced from PubChem (CID 15569771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).