About ethane;ethene;N-methylbut-3-en-2-imine
ethane;ethene;N-methylbut-3-en-2-imine (PubChem CID 155698554) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is ethane;ethene;N-methylbut-3-en-2-imine.
Molecular Properties
| Compound Name | ethane;ethene;N-methylbut-3-en-2-imine |
| PubChem CID | 155698554 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | ethane;ethene;N-methylbut-3-en-2-imine |
| SMILES | C=C.C=C/C(C)=N/C.CC |
| InChI | InChI=1S/C5H9N.C2H6.C2H4/c1-4-5(2)6-3;2*1-2/h4H,1H2,2-3H3;1-2H3;1-2H2/b6-5+;; |
| InChIKey | KCHGMICFXDHIMS-TXOOBNKBSA-N |
| XLogP | 3.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;N-methylbut-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;N-methylbut-3-en-2-imine?
The IUPAC name of ethane;ethene;N-methylbut-3-en-2-imine (CID 155698554) is ethane;ethene;N-methylbut-3-en-2-imine.
What is the SMILES notation for ethane;ethene;N-methylbut-3-en-2-imine?
The canonical SMILES for ethane;ethene;N-methylbut-3-en-2-imine is C=C.C=C/C(C)=N/C.CC.
What is the InChIKey of ethane;ethene;N-methylbut-3-en-2-imine?
The InChIKey is KCHGMICFXDHIMS-TXOOBNKBSA-N. The full InChI is InChI=1S/C5H9N.C2H6.C2H4/c1-4-5(2)6-3;2*1-2/h4H,1H2,2-3H3;1-2H3;1-2H2/b6-5+;;.
What are the key properties of ethane;ethene;N-methylbut-3-en-2-imine?
ethane;ethene;N-methylbut-3-en-2-imine has a molecular weight of 141.26 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;N-methylbut-3-en-2-imine is sourced from PubChem (CID 155698554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).