About 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole
3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole (PubChem CID 155698557) has the molecular formula C12H14F3N
and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole.
Molecular Properties
| Compound Name | 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole |
| PubChem CID | 155698557 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole |
| SMILES | CCCC1=C(C(F)(F)F)NC2C=CC=CC12 |
| InChI | InChI=1S/C12H14F3N/c1-2-5-9-8-6-3-4-7-10(8)16-11(9)12(13,14)15/h3-4,6-8,10,16H,2,5H2,1H3 |
| InChIKey | WAZVZTGSQOCSLJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole?
The IUPAC name of 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole (CID 155698557) is 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole.
What is the SMILES notation for 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole?
The canonical SMILES for 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole is CCCC1=C(C(F)(F)F)NC2C=CC=CC12.
What is the InChIKey of 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole?
The InChIKey is WAZVZTGSQOCSLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N/c1-2-5-9-8-6-3-4-7-10(8)16-11(9)12(13,14)15/h3-4,6-8,10,16H,2,5H2,1H3.
What are the key properties of 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole?
3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole has a molecular weight of 229.24 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-2-(trifluoromethyl)-3a,7a-dihydro-1H-indole is sourced from PubChem (CID 155698557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).