C9H11NO4 — CID 15569862
methyl N-(2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl)carbamate (PubChem CID 15569862) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is methyl N-(2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl)carbamate.
| Compound Name | methyl N-(2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl)carbamate |
|---|---|
| PubChem CID | 15569862 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | methyl N-(2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl)carbamate |
| SMILES | COC(=O)NC1C(=O)OC2C=CCC21 |
| InChI | InChI=1S/C9H11NO4/c1-13-9(12)10-7-5-3-2-4-6(5)14-8(7)11/h2,4-7H,3H2,1H3,(H,10,12) |
| InChIKey | LRMNSWYMHKPDFS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|