About 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one
2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one (PubChem CID 155699291) has the molecular formula C21H13N3O3
and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one.
Molecular Properties
| Compound Name | 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one |
| PubChem CID | 155699291 |
| Molecular Formula | C21H13N3O3 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one |
| SMILES | O=c1[nH]c2ccc(-c3ccccc3[N+](=O)[O-])cc2c2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C21H13N3O3/c25-21-19-14-6-1-3-7-16(14)22-20(19)15-11-12(9-10-17(15)23-21)13-5-2-4-8-18(13)24(26)27/h1-11,22H,(H,23,25) |
| InChIKey | DXTDUPZPCPAFRS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one?
The IUPAC name of 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one (CID 155699291) is 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one.
What is the SMILES notation for 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one?
The canonical SMILES for 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one is O=c1[nH]c2ccc(-c3ccccc3[N+](=O)[O-])cc2c2[nH]c3ccccc3c12.
What is the InChIKey of 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one?
The InChIKey is DXTDUPZPCPAFRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13N3O3/c25-21-19-14-6-1-3-7-16(14)22-20(19)15-11-12(9-10-17(15)23-21)13-5-2-4-8-18(13)24(26)27/h1-11,22H,(H,23,25).
What are the key properties of 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one?
2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one has a molecular weight of 355.35 g/mol, XLogP of 4.74, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitrophenyl)-5,11-dihydroindolo[3,2-c]quinolin-6-one is sourced from PubChem (CID 155699291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).