C18H15F5N2O3 — CID 155699560
2,3,4,5,6-pentafluoro-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-N-propan-2-ylbenzamide (PubChem CID 155699560) has the molecular formula C18H15F5N2O3 and a molecular weight of 402.32 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-N-propan-2-ylbenzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 155699560 |
| Molecular Formula | C18H15F5N2O3 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(Cc1ccc(C(=O)NO)cc1)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H15F5N2O3/c1-8(2)25(7-9-3-5-10(6-4-9)17(26)24-28)18(27)11-12(19)14(21)16(23)15(22)13(11)20/h3-6,8,28H,7H2,1-2H3,(H,24,26) |
| InChIKey | HTDWCWRHHQCVJF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|