C16H15BrFN3OS — CID 155700104
5-bromo-N-[5-[(3-fluorophenyl)methyl]-2-pyridinyl]-1,2-thiazolidine-3-carboxamide (PubChem CID 155700104) has the molecular formula C16H15BrFN3OS and a molecular weight of 396.29 g/mol. Its IUPAC name is 5-bromo-N-[5-[(3-fluorophenyl)methyl]-2-pyridinyl]-1,2-thiazolidine-3-carboxamide.
| Compound Name | 5-bromo-N-[5-[(3-fluorophenyl)methyl]-2-pyridinyl]-1,2-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 155700104 |
| Molecular Formula | C16H15BrFN3OS |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 5-bromo-N-[5-[(3-fluorophenyl)methyl]-2-pyridinyl]-1,2-thiazolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cc2cccc(F)c2)cn1)C1CC(Br)SN1 |
| InChI | InChI=1S/C16H15BrFN3OS/c17-14-8-13(21-23-14)16(22)20-15-5-4-11(9-19-15)6-10-2-1-3-12(18)7-10/h1-5,7,9,13-14,21H,6,8H2,(H,19,20,22) |
| InChIKey | WMZLKZUSZIXAIL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|