C22H45N3O4 — CID 15570048
tert-butyl N-[6-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylamino]hexyl]carbamate (PubChem CID 15570048) has the molecular formula C22H45N3O4 and a molecular weight of 415.62 g/mol. Its IUPAC name is tert-butyl N-[6-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 15570048 |
| Molecular Formula | C22H45N3O4 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.34 |
| IUPAC Name | tert-butyl N-[6-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylamino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNCCCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H45N3O4/c1-21(2,3)28-19(26)24-17-13-9-7-11-15-23-16-12-8-10-14-18-25-20(27)29-22(4,5)6/h23H,7-18H2,1-6H3,(H,24,26)(H,25,27) |
| InChIKey | CHPQVDAQBKJOGI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|