C16H22N2O — CID 155701198
4-[5,6-bis(ethenyl)-2,3-dihydro-1,4-oxazin-4-yl]aniline;ethane (PubChem CID 155701198) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 4-[5,6-bis(ethenyl)-2,3-dihydro-1,4-oxazin-4-yl]aniline;ethane.
| Compound Name | 4-[5,6-bis(ethenyl)-2,3-dihydro-1,4-oxazin-4-yl]aniline;ethane |
|---|---|
| PubChem CID | 155701198 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 4-[5,6-bis(ethenyl)-2,3-dihydro-1,4-oxazin-4-yl]aniline;ethane |
| SMILES | C=CC1=C(C=C)N(c2ccc(N)cc2)CCO1.CC |
| InChI | InChI=1S/C14H16N2O.C2H6/c1-3-13-14(4-2)17-10-9-16(13)12-7-5-11(15)6-8-12;1-2/h3-8H,1-2,9-10,15H2;1-2H3 |
| InChIKey | LTRQIIGPHIHQLC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|