C17H27N7O2 — CID 155701224
(7E)-8-(methylaminomethyl)-5-methylimino-2,6,10,14,19-pentazatricyclo[12.3.1.13,7]nonadeca-3,7-diene-9,13-dione (PubChem CID 155701224) has the molecular formula C17H27N7O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is (7E)-8-(methylaminomethyl)-5-methylimino-2,6,10,14,19-pentazatricyclo[12.3.1.13,7]nonadeca-3,7-diene-9,13-dione.
| Compound Name | (7E)-8-(methylaminomethyl)-5-methylimino-2,6,10,14,19-pentazatricyclo[12.3.1.13,7]nonadeca-3,7-diene-9,13-dione |
|---|---|
| PubChem CID | 155701224 |
| Molecular Formula | C17H27N7O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (7E)-8-(methylaminomethyl)-5-methylimino-2,6,10,14,19-pentazatricyclo[12.3.1.13,7]nonadeca-3,7-diene-9,13-dione |
| SMILES | C/N=C1\C=C2N/C(=C(/CNC)C(=O)NCCC(=O)N3CCCC(C3)N2)N1 |
| InChI | InChI=1S/C17H27N7O2/c1-18-9-12-16-22-13(19-2)8-14(23-16)21-11-4-3-7-24(10-11)15(25)5-6-20-17(12)26/h8,11,18,21,23H,3-7,9-10H2,1-2H3,(H,19,22)(H,20,26)/b16-12- |
| InChIKey | MDRGALDUEVKAER-VBKFSLOCSA-N |
| XLogP | -1.42 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|