About 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole
2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole (PubChem CID 155701480) has the molecular formula C29H37N3
and a molecular weight of 427.64 g/mol. Its IUPAC name is 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole.
Molecular Properties
| Compound Name | 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole |
| PubChem CID | 155701480 |
| Molecular Formula | C29H37N3 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.30 |
| IUPAC Name | 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole |
| SMILES | C=C(C)c1ccc(-c2c[nH]c3ccc(C)cc23)cc1.CCCC(CCC)c1ncc(C)[nH]1 |
| InChI | InChI=1S/C18H17N.C11H20N2/c1-12(2)14-5-7-15(8-6-14)17-11-19-18-9-4-13(3)10-16(17)18;1-4-6-10(7-5-2)11-12-8-9(3)13-11/h4-11,19H,1H2,2-3H3;8,10H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | UYEIQRXUPUKBTG-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole?
The IUPAC name of 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole (CID 155701480) is 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole.
What is the SMILES notation for 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole?
The canonical SMILES for 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole is C=C(C)c1ccc(-c2c[nH]c3ccc(C)cc23)cc1.CCCC(CCC)c1ncc(C)[nH]1.
What is the InChIKey of 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole?
The InChIKey is UYEIQRXUPUKBTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N.C11H20N2/c1-12(2)14-5-7-15(8-6-14)17-11-19-18-9-4-13(3)10-16(17)18;1-4-6-10(7-5-2)11-12-8-9(3)13-11/h4-11,19H,1H2,2-3H3;8,10H,4-7H2,1-3H3,(H,12,13).
What are the key properties of 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole?
2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole has a molecular weight of 427.64 g/mol, XLogP of 8.58, 7 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptan-4-yl-5-methyl-1H-imidazole;5-methyl-3-(4-prop-1-en-2-ylphenyl)-1H-indole is sourced from PubChem (CID 155701480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).