C19H20F3N5O — CID 155701537
N-(4-cyclopropylphenyl)-4-[6-(trifluoromethyl)pyridazin-3-yl]piperazine-1-carboxamide (PubChem CID 155701537) has the molecular formula C19H20F3N5O and a molecular weight of 391.40 g/mol. Its IUPAC name is N-(4-cyclopropylphenyl)-4-[6-(trifluoromethyl)pyridazin-3-yl]piperazine-1-carboxamide.
| Compound Name | N-(4-cyclopropylphenyl)-4-[6-(trifluoromethyl)pyridazin-3-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 155701537 |
| Molecular Formula | C19H20F3N5O |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-(4-cyclopropylphenyl)-4-[6-(trifluoromethyl)pyridazin-3-yl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(C2CC2)cc1)N1CCN(c2ccc(C(F)(F)F)nn2)CC1 |
| InChI | InChI=1S/C19H20F3N5O/c20-19(21,22)16-7-8-17(25-24-16)26-9-11-27(12-10-26)18(28)23-15-5-3-14(4-6-15)13-1-2-13/h3-8,13H,1-2,9-12H2,(H,23,28) |
| InChIKey | GXALDKGDDKDUFP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |