C6H3FN2OS — CID 155701556
6-fluoro-3H-[1,3]oxazolo[4,5-b]pyridine-2-thione (PubChem CID 155701556) has the molecular formula C6H3FN2OS and a molecular weight of 170.17 g/mol. Its IUPAC name is 6-fluoro-3H-[1,3]oxazolo[4,5-b]pyridine-2-thione.
| Compound Name | 6-fluoro-3H-[1,3]oxazolo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 155701556 |
| Molecular Formula | C6H3FN2OS |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 6-fluoro-3H-[1,3]oxazolo[4,5-b]pyridine-2-thione |
| SMILES | Fc1cnc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C6H3FN2OS/c7-3-1-4-5(8-2-3)9-6(11)10-4/h1-2H,(H,8,9,11) |
| InChIKey | PASHIWXZYPDKRA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|