C13H30OSi2 — CID 15570156
(E)-1,3-bis(trimethylsilyl)hept-1-en-4-ol (PubChem CID 15570156) has the molecular formula C13H30OSi2 and a molecular weight of 258.55 g/mol. Its IUPAC name is (E)-1,3-bis(trimethylsilyl)hept-1-en-4-ol.
| Compound Name | (E)-1,3-bis(trimethylsilyl)hept-1-en-4-ol |
|---|---|
| PubChem CID | 15570156 |
| Molecular Formula | C13H30OSi2 |
| Molecular Weight | 258.55 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (E)-1,3-bis(trimethylsilyl)hept-1-en-4-ol |
| SMILES | CCCC(O)C(/C=C/[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H30OSi2/c1-8-9-12(14)13(16(5,6)7)10-11-15(2,3)4/h10-14H,8-9H2,1-7H3/b11-10+ |
| InChIKey | HACYHPQWIDVIGH-ZHACJKMWSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|