C12H18F3N3OS — CID 155701893
ethane;N-(3,3,3-trifluoropropyl)-4,5,6,7-tetrahydro-[1,2]thiazolo[4,5-c]pyridine-3-carboxamide (PubChem CID 155701893) has the molecular formula C12H18F3N3OS and a molecular weight of 309.36 g/mol. Its IUPAC name is ethane;N-(3,3,3-trifluoropropyl)-4,5,6,7-tetrahydro-[1,2]thiazolo[4,5-c]pyridine-3-carboxamide.
| Compound Name | ethane;N-(3,3,3-trifluoropropyl)-4,5,6,7-tetrahydro-[1,2]thiazolo[4,5-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155701893 |
| Molecular Formula | C12H18F3N3OS |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | ethane;N-(3,3,3-trifluoropropyl)-4,5,6,7-tetrahydro-[1,2]thiazolo[4,5-c]pyridine-3-carboxamide |
| SMILES | CC.O=C(NCCC(F)(F)F)c1nsc2c1CNCC2 |
| InChI | InChI=1S/C10H12F3N3OS.C2H6/c11-10(12,13)2-4-15-9(17)8-6-5-14-3-1-7(6)18-16-8;1-2/h14H,1-5H2,(H,15,17);1-2H3 |
| InChIKey | TVYHLWHZQOWTFX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |