About ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide
ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide (PubChem CID 155701905) has the molecular formula C9H18F3NO2
and a molecular weight of 229.24 g/mol. Its IUPAC name is ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide.
Molecular Properties
| Compound Name | ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide |
| PubChem CID | 155701905 |
| Molecular Formula | C9H18F3NO2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide |
| SMILES | CC.CC(=O)NCC(CO)CC(F)(F)F |
| InChI | InChI=1S/C7H12F3NO2.C2H6/c1-5(13)11-3-6(4-12)2-7(8,9)10;1-2/h6,12H,2-4H2,1H3,(H,11,13);1-2H3 |
| InChIKey | QWWSIOBCVBKTJF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide?
The IUPAC name of ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide (CID 155701905) is ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide.
What is the SMILES notation for ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide?
The canonical SMILES for ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide is CC.CC(=O)NCC(CO)CC(F)(F)F.
What is the InChIKey of ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide?
The InChIKey is QWWSIOBCVBKTJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3NO2.C2H6/c1-5(13)11-3-6(4-12)2-7(8,9)10;1-2/h6,12H,2-4H2,1H3,(H,11,13);1-2H3.
What are the key properties of ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide?
ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide has a molecular weight of 229.24 g/mol, XLogP of 1.71, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide is sourced from PubChem (CID 155701905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).