C9H18F3NO2 — CID 155701905
ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide (PubChem CID 155701905) has the molecular formula C9H18F3NO2 and a molecular weight of 229.24 g/mol. Its IUPAC name is ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide.
| Compound Name | ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide |
|---|---|
| PubChem CID | 155701905 |
| Molecular Formula | C9H18F3NO2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | ethane;N-[4,4,4-trifluoro-2-(hydroxymethyl)butyl]acetamide |
| SMILES | CC.CC(=O)NCC(CO)CC(F)(F)F |
| InChI | InChI=1S/C7H12F3NO2.C2H6/c1-5(13)11-3-6(4-12)2-7(8,9)10;1-2/h6,12H,2-4H2,1H3,(H,11,13);1-2H3 |
| InChIKey | QWWSIOBCVBKTJF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |