C20H23F3N6O2S — CID 155701916
ethane;5-(7-sulfanylpyrrolo[2,3-d]pyrimidin-4-yl)-N-(3,3,3-trifluoropropyl)spiro[4,6-dihydro-[1,2]oxazolo[4,5-c]pyridine-7,1'-cyclopropane]-3-carboxamide (PubChem CID 155701916) has the molecular formula C20H23F3N6O2S and a molecular weight of 468.51 g/mol. Its IUPAC name is ethane;5-(7-sulfanylpyrrolo[2,3-d]pyrimidin-4-yl)-N-(3,3,3-trifluoropropyl)spiro[4,6-dihydro-[1,2]oxazolo[4,5-c]pyridine-7,1'-cyclopropane]-3-carboxamide.
| Compound Name | ethane;5-(7-sulfanylpyrrolo[2,3-d]pyrimidin-4-yl)-N-(3,3,3-trifluoropropyl)spiro[4,6-dihydro-[1,2]oxazolo[4,5-c]pyridine-7,1'-cyclopropane]-3-carboxamide |
|---|---|
| PubChem CID | 155701916 |
| Molecular Formula | C20H23F3N6O2S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | ethane;5-(7-sulfanylpyrrolo[2,3-d]pyrimidin-4-yl)-N-(3,3,3-trifluoropropyl)spiro[4,6-dihydro-[1,2]oxazolo[4,5-c]pyridine-7,1'-cyclopropane]-3-carboxamide |
| SMILES | CC.O=C(NCCC(F)(F)F)c1noc2c1CN(c1ncnc3c1ccn3S)CC21CC1 |
| InChI | InChI=1S/C18H17F3N6O2S.C2H6/c19-18(20,21)4-5-22-16(28)12-11-7-26(8-17(2-3-17)13(11)29-25-12)14-10-1-6-27(30)15(10)24-9-23-14;1-2/h1,6,9,30H,2-5,7-8H2,(H,22,28);1-2H3 |
| InChIKey | PJRUDKCEBJEUKF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|