About 9-oxoundecyl 2,2,2-trifluoroacetate
9-oxoundecyl 2,2,2-trifluoroacetate (PubChem CID 155702251) has the molecular formula C13H21F3O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is 9-oxoundecyl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 9-oxoundecyl 2,2,2-trifluoroacetate |
| PubChem CID | 155702251 |
| Molecular Formula | C13H21F3O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 9-oxoundecyl 2,2,2-trifluoroacetate |
| SMILES | CCC(=O)CCCCCCCCOC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H21F3O3/c1-2-11(17)9-7-5-3-4-6-8-10-19-12(18)13(14,15)16/h2-10H2,1H3 |
| InChIKey | HEZLKYBCIGVTSX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-oxoundecyl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-oxoundecyl 2,2,2-trifluoroacetate?
The IUPAC name of 9-oxoundecyl 2,2,2-trifluoroacetate (CID 155702251) is 9-oxoundecyl 2,2,2-trifluoroacetate.
What is the SMILES notation for 9-oxoundecyl 2,2,2-trifluoroacetate?
The canonical SMILES for 9-oxoundecyl 2,2,2-trifluoroacetate is CCC(=O)CCCCCCCCOC(=O)C(F)(F)F.
What is the InChIKey of 9-oxoundecyl 2,2,2-trifluoroacetate?
The InChIKey is HEZLKYBCIGVTSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F3O3/c1-2-11(17)9-7-5-3-4-6-8-10-19-12(18)13(14,15)16/h2-10H2,1H3.
What are the key properties of 9-oxoundecyl 2,2,2-trifluoroacetate?
9-oxoundecyl 2,2,2-trifluoroacetate has a molecular weight of 282.30 g/mol, XLogP of 3.80, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxoundecyl 2,2,2-trifluoroacetate is sourced from PubChem (CID 155702251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).