About tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane
tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane (PubChem CID 155702470) has the molecular formula C18H31F3N2OSn
and a molecular weight of 467.16 g/mol. Its IUPAC name is tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane.
Molecular Properties
| Compound Name | tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane |
| PubChem CID | 155702470 |
| Molecular Formula | C18H31F3N2OSn |
| Molecular Weight | 467.16 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ncc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C6H4F3N2O.3C4H9.Sn/c7-6(8,9)3-12-5-1-10-4-11-2-5;3*1-3-4-2;/h1-2H,3H2;3*1,3-4H2,2H3; |
| InChIKey | WDLSJXNZTWUPKS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.16 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane?
The IUPAC name of tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane (CID 155702470) is tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane.
What is the SMILES notation for tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane?
The canonical SMILES for tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane is CCCC[Sn](CCCC)(CCCC)c1ncc(OCC(F)(F)F)cn1.
What is the InChIKey of tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane?
The InChIKey is WDLSJXNZTWUPKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3N2O.3C4H9.Sn/c7-6(8,9)3-12-5-1-10-4-11-2-5;3*1-3-4-2;/h1-2H,3H2;3*1,3-4H2,2H3;.
What are the key properties of tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane?
tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane has a molecular weight of 467.16 g/mol, XLogP of 5.47, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[5-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]stannane is sourced from PubChem (CID 155702470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).