About ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane
ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane (PubChem CID 155702490) has the molecular formula C16H33N3
and a molecular weight of 267.46 g/mol. Its IUPAC name is ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane.
Molecular Properties
| Compound Name | ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane |
| PubChem CID | 155702490 |
| Molecular Formula | C16H33N3 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.27 |
| IUPAC Name | ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane |
| SMILES | CC.CC(C)N1CC2(CN(CC3CCNCC3)C2)C1 |
| InChI | InChI=1S/C14H27N3.C2H6/c1-12(2)17-10-14(11-17)8-16(9-14)7-13-3-5-15-6-4-13;1-2/h12-13,15H,3-11H2,1-2H3;1-2H3 |
| InChIKey | GNKPTOLGLFPBEI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane?
The IUPAC name of ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane (CID 155702490) is ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane.
What is the SMILES notation for ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane?
The canonical SMILES for ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane is CC.CC(C)N1CC2(CN(CC3CCNCC3)C2)C1.
What is the InChIKey of ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane?
The InChIKey is GNKPTOLGLFPBEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3.C2H6/c1-12(2)17-10-14(11-17)8-16(9-14)7-13-3-5-15-6-4-13;1-2/h12-13,15H,3-11H2,1-2H3;1-2H3.
What are the key properties of ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane?
ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane has a molecular weight of 267.46 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-(piperidin-4-ylmethyl)-2-propan-2-yl-2,6-diazaspiro[3.3]heptane is sourced from PubChem (CID 155702490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).