About 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane
2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane (PubChem CID 155702809) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane.
Molecular Properties
| Compound Name | 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane |
| PubChem CID | 155702809 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane |
| SMILES | CC.Cc1ccc2nc(C)cc(=O)n2c1 |
| InChI | InChI=1S/C10H10N2O.C2H6/c1-7-3-4-9-11-8(2)5-10(13)12(9)6-7;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | YXSMPVWCLJFJBJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane?
The IUPAC name of 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane (CID 155702809) is 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane.
What is the SMILES notation for 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane?
The canonical SMILES for 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane is CC.Cc1ccc2nc(C)cc(=O)n2c1.
What is the InChIKey of 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane?
The InChIKey is YXSMPVWCLJFJBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O.C2H6/c1-7-3-4-9-11-8(2)5-10(13)12(9)6-7;1-2/h3-6H,1-2H3;1-2H3.
What are the key properties of 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane?
2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane has a molecular weight of 204.27 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylpyrido[1,2-a]pyrimidin-4-one;ethane is sourced from PubChem (CID 155702809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).