About ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene
ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 155702888) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene |
| PubChem CID | 155702888 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | C1=CC2CCC1O2.CC.CN |
| InChI | InChI=1S/C6H8O.C2H6.CH5N/c1-2-6-4-3-5(1)7-6;2*1-2/h1-2,5-6H,3-4H2;1-2H3;2H2,1H3 |
| InChIKey | PMLYMXLYOBOEJR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene?
The IUPAC name of ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene (CID 155702888) is ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene?
The canonical SMILES for ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene is C1=CC2CCC1O2.CC.CN.
What is the InChIKey of ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene?
The InChIKey is PMLYMXLYOBOEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O.C2H6.CH5N/c1-2-6-4-3-5(1)7-6;2*1-2/h1-2,5-6H,3-4H2;1-2H3;2H2,1H3.
What are the key properties of ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene?
ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene has a molecular weight of 157.26 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanamine;7-oxabicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 155702888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).