About ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine
ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine (PubChem CID 155702969) has the molecular formula C18H32N2
and a molecular weight of 276.47 g/mol. Its IUPAC name is ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine.
Molecular Properties
| Compound Name | ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine |
| PubChem CID | 155702969 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine |
| SMILES | C/C=C(C)\C=C/C1=C(C)CC2(CCNCC2)C1N.CC |
| InChI | InChI=1S/C16H26N2.C2H6/c1-4-12(2)5-6-14-13(3)11-16(15(14)17)7-9-18-10-8-16;1-2/h4-6,15,18H,7-11,17H2,1-3H3;1-2H3/b6-5-,12-4-; |
| InChIKey | VQPSFRLZENNGAV-BWUFFIINSA-N |
| XLogP | 3.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine?
The IUPAC name of ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine (CID 155702969) is ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine.
What is the SMILES notation for ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine?
The canonical SMILES for ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine is C/C=C(C)\C=C/C1=C(C)CC2(CCNCC2)C1N.CC.
What is the InChIKey of ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine?
The InChIKey is VQPSFRLZENNGAV-BWUFFIINSA-N. The full InChI is InChI=1S/C16H26N2.C2H6/c1-4-12(2)5-6-14-13(3)11-16(15(14)17)7-9-18-10-8-16;1-2/h4-6,15,18H,7-11,17H2,1-3H3;1-2H3/b6-5-,12-4-;.
What are the key properties of ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine?
ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine has a molecular weight of 276.47 g/mol, XLogP of 3.95, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-3-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-4-amine is sourced from PubChem (CID 155702969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).