About 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine
3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine (PubChem CID 155703014) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine.
Molecular Properties
| Compound Name | 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine |
| PubChem CID | 155703014 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine |
| SMILES | C=C/C(=C\C1=C(C)CC2(CCNCC2)C1N)CC |
| InChI | InChI=1S/C16H26N2/c1-4-13(5-2)10-14-12(3)11-16(15(14)17)6-8-18-9-7-16/h4,10,15,18H,1,5-9,11,17H2,2-3H3/b13-10+ |
| InChIKey | QSMCTMAXOHMDQE-JLHYYAGUSA-N |
| XLogP | 2.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine?
The IUPAC name of 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine (CID 155703014) is 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine.
What is the SMILES notation for 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine?
The canonical SMILES for 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine is C=C/C(=C\C1=C(C)CC2(CCNCC2)C1N)CC.
What is the InChIKey of 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine?
The InChIKey is QSMCTMAXOHMDQE-JLHYYAGUSA-N. The full InChI is InChI=1S/C16H26N2/c1-4-13(5-2)10-14-12(3)11-16(15(14)17)6-8-18-9-7-16/h4,10,15,18H,1,5-9,11,17H2,2-3H3/b13-10+.
What are the key properties of 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine?
3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine has a molecular weight of 246.40 g/mol, XLogP of 2.93, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-2-ethylbuta-1,3-dienyl]-2-methyl-8-azaspiro[4.5]dec-2-en-4-amine is sourced from PubChem (CID 155703014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).