About 3-methylnona-1,2-diene
3-methylnona-1,2-diene (PubChem CID 15570329) has the molecular formula C10H18
and a molecular weight of 138.25 g/mol. Its IUPAC name is 3-methylnona-1,2-diene.
Molecular Properties
| Compound Name | 3-methylnona-1,2-diene |
| PubChem CID | 15570329 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | 3-methylnona-1,2-diene |
| SMILES | C=C=C(C)CCCCCC |
| InChI | InChI=1S/C10H18/c1-4-6-7-8-9-10(3)5-2/h2,4,6-9H2,1,3H3 |
| InChIKey | CASWNURPBNQLDL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylnona-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylnona-1,2-diene?
The IUPAC name of 3-methylnona-1,2-diene (CID 15570329) is 3-methylnona-1,2-diene.
What is the SMILES notation for 3-methylnona-1,2-diene?
The canonical SMILES for 3-methylnona-1,2-diene is C=C=C(C)CCCCCC.
What is the InChIKey of 3-methylnona-1,2-diene?
The InChIKey is CASWNURPBNQLDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18/c1-4-6-7-8-9-10(3)5-2/h2,4,6-9H2,1,3H3.
What are the key properties of 3-methylnona-1,2-diene?
3-methylnona-1,2-diene has a molecular weight of 138.25 g/mol, XLogP of 3.69, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylnona-1,2-diene is sourced from PubChem (CID 15570329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).