About 1,2-bis(ethenoxy)propane
1,2-bis(ethenoxy)propane (PubChem CID 15570361) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 1,2-bis(ethenoxy)propane.
Molecular Properties
| Compound Name | 1,2-bis(ethenoxy)propane |
| PubChem CID | 15570361 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 1,2-bis(ethenoxy)propane |
| SMILES | C=COCC(C)OC=C |
| InChI | InChI=1S/C7H12O2/c1-4-8-6-7(3)9-5-2/h4-5,7H,1-2,6H2,3H3 |
| InChIKey | LXSVCBDMOGLGFA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(ethenoxy)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(ethenoxy)propane?
The IUPAC name of 1,2-bis(ethenoxy)propane (CID 15570361) is 1,2-bis(ethenoxy)propane.
What is the SMILES notation for 1,2-bis(ethenoxy)propane?
The canonical SMILES for 1,2-bis(ethenoxy)propane is C=COCC(C)OC=C.
What is the InChIKey of 1,2-bis(ethenoxy)propane?
The InChIKey is LXSVCBDMOGLGFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-4-8-6-7(3)9-5-2/h4-5,7H,1-2,6H2,3H3.
What are the key properties of 1,2-bis(ethenoxy)propane?
1,2-bis(ethenoxy)propane has a molecular weight of 128.17 g/mol, XLogP of 1.70, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(ethenoxy)propane is sourced from PubChem (CID 15570361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).