C34H29F6NO5 — CID 155703740
(E)-3-[4-[[6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-oxo-7,8-dihydro-6H-naphthalen-2-yl]oxymethyl]cyclohexa-1,2,3,5-tetraen-1-yl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 155703740) has the molecular formula C34H29F6NO5 and a molecular weight of 645.60 g/mol. Its IUPAC name is (E)-3-[4-[[6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-oxo-7,8-dihydro-6H-naphthalen-2-yl]oxymethyl]cyclohexa-1,2,3,5-tetraen-1-yl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[4-[[6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-oxo-7,8-dihydro-6H-naphthalen-2-yl]oxymethyl]cyclohexa-1,2,3,5-tetraen-1-yl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 155703740 |
| Molecular Formula | C34H29F6NO5 |
| Molecular Weight | 645.60 g/mol |
| Exact Mass | 645.19 |
| IUPAC Name | (E)-3-[4-[[6-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-oxo-7,8-dihydro-6H-naphthalen-2-yl]oxymethyl]cyclohexa-1,2,3,5-tetraen-1-yl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(/C=C/C1=C=C=C(COc2ccc3c(c2)CCC(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C3=O)C=C1)NOC1CCCCO1 |
| InChI | InChI=1S/C34H29F6NO5/c35-33(36,37)26-16-23(17-27(19-26)34(38,39)40)15-25-10-9-24-18-28(11-12-29(24)32(25)43)45-20-22-6-4-21(5-7-22)8-13-30(42)41-46-31-3-1-2-14-44-31/h4,6,8,11-13,16-19,25,31H,1-3,9-10,14-15,20H2,(H,41,42)/b13-8+ |
| InChIKey | LBKOOBQSQHZEAQ-MDWZMJQESA-N |
| XLogP | 7.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|