C22H28N2O3Y — CID 155703832
4-(dimethylamino)-N-[5-[(E)-2-hydroxyethenyl]-2,3-dihydro-1H-inden-1-yl]benzamide;ethanol;yttrium (PubChem CID 155703832) has the molecular formula C22H28N2O3Y and a molecular weight of 457.38 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[5-[(E)-2-hydroxyethenyl]-2,3-dihydro-1H-inden-1-yl]benzamide;ethanol;yttrium.
| Compound Name | 4-(dimethylamino)-N-[5-[(E)-2-hydroxyethenyl]-2,3-dihydro-1H-inden-1-yl]benzamide;ethanol;yttrium |
|---|---|
| PubChem CID | 155703832 |
| Molecular Formula | C22H28N2O3Y |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 4-(dimethylamino)-N-[5-[(E)-2-hydroxyethenyl]-2,3-dihydro-1H-inden-1-yl]benzamide;ethanol;yttrium |
| SMILES | CCO.CN(C)c1ccc(C(=O)NC2CCc3cc(/C=C/O)ccc32)cc1.[Y] |
| InChI | InChI=1S/C20H22N2O2.C2H6O.Y/c1-22(2)17-7-4-15(5-8-17)20(24)21-19-10-6-16-13-14(11-12-23)3-9-18(16)19;1-2-3;/h3-5,7-9,11-13,19,23H,6,10H2,1-2H3,(H,21,24);3H,2H2,1H3;/b12-11+;; |
| InChIKey | OTUVHRBZSIOXHT-YHPRVSEPSA-N |
| XLogP | 3.69 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|