C19H35N3O3S2 — CID 155704773
ethane;methoxyethane;2-[(Z)-1-[(1,3,4-trimethyl-2-oxo-6-sulfanylidenepyrimidin-5-yl)amino]pent-1-enyl]sulfanylacetaldehyde (PubChem CID 155704773) has the molecular formula C19H35N3O3S2 and a molecular weight of 417.64 g/mol. Its IUPAC name is ethane;methoxyethane;2-[(Z)-1-[(1,3,4-trimethyl-2-oxo-6-sulfanylidenepyrimidin-5-yl)amino]pent-1-enyl]sulfanylacetaldehyde.
| Compound Name | ethane;methoxyethane;2-[(Z)-1-[(1,3,4-trimethyl-2-oxo-6-sulfanylidenepyrimidin-5-yl)amino]pent-1-enyl]sulfanylacetaldehyde |
|---|---|
| PubChem CID | 155704773 |
| Molecular Formula | C19H35N3O3S2 |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | ethane;methoxyethane;2-[(Z)-1-[(1,3,4-trimethyl-2-oxo-6-sulfanylidenepyrimidin-5-yl)amino]pent-1-enyl]sulfanylacetaldehyde |
| SMILES | CC.CCC/C=C(/Nc1c(C)n(C)c(=O)n(C)c1=S)SCC=O.CCOC |
| InChI | InChI=1S/C14H21N3O2S2.C3H8O.C2H6/c1-5-6-7-11(21-9-8-18)15-12-10(2)16(3)14(19)17(4)13(12)20;1-3-4-2;1-2/h7-8,15H,5-6,9H2,1-4H3;3H2,1-2H3;1-2H3/b11-7-;; |
| InChIKey | REAJIZCCXIBFDC-FJJKMGSJSA-N |
| XLogP | 4.43 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|