About ethane;7-methylpyrrolo[2,3-d]pyrimidine
ethane;7-methylpyrrolo[2,3-d]pyrimidine (PubChem CID 155705341) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is ethane;7-methylpyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | ethane;7-methylpyrrolo[2,3-d]pyrimidine |
| PubChem CID | 155705341 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | ethane;7-methylpyrrolo[2,3-d]pyrimidine |
| SMILES | CC.CC.Cn1ccc2cncnc21 |
| InChI | InChI=1S/C7H7N3.2C2H6/c1-10-3-2-6-4-8-5-9-7(6)10;2*1-2/h2-5H,1H3;2*1-2H3 |
| InChIKey | HOXAPAYJTLFZAM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;7-methylpyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methylpyrrolo[2,3-d]pyrimidine?
The IUPAC name of ethane;7-methylpyrrolo[2,3-d]pyrimidine (CID 155705341) is ethane;7-methylpyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for ethane;7-methylpyrrolo[2,3-d]pyrimidine?
The canonical SMILES for ethane;7-methylpyrrolo[2,3-d]pyrimidine is CC.CC.Cn1ccc2cncnc21.
What is the InChIKey of ethane;7-methylpyrrolo[2,3-d]pyrimidine?
The InChIKey is HOXAPAYJTLFZAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.2C2H6/c1-10-3-2-6-4-8-5-9-7(6)10;2*1-2/h2-5H,1H3;2*1-2H3.
What are the key properties of ethane;7-methylpyrrolo[2,3-d]pyrimidine?
ethane;7-methylpyrrolo[2,3-d]pyrimidine has a molecular weight of 193.29 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methylpyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 155705341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).