C12H26O2 — CID 155705363
(3S)-3-ethyl-3-methylhex-1-ene;propane-2,2-diol (PubChem CID 155705363) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is (3S)-3-ethyl-3-methylhex-1-ene;propane-2,2-diol.
| Compound Name | (3S)-3-ethyl-3-methylhex-1-ene;propane-2,2-diol |
|---|---|
| PubChem CID | 155705363 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | (3S)-3-ethyl-3-methylhex-1-ene;propane-2,2-diol |
| SMILES | C=C[C@@](C)(CC)CCC.CC(C)(O)O |
| InChI | InChI=1S/C9H18.C3H8O2/c1-5-8-9(4,6-2)7-3;1-3(2,4)5/h6H,2,5,7-8H2,1,3-4H3;4-5H,1-2H3/t9-;/m0./s1 |
| InChIKey | YDJAKDBQHPGECP-FVGYRXGTSA-N |
| XLogP | 3.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|