C28H34N6O2 — CID 155705411
butyl N-[7-[2-[(1S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1-methylcyclopentyl]ethyl]quinolin-2-yl]carbamate (PubChem CID 155705411) has the molecular formula C28H34N6O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is butyl N-[7-[2-[(1S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1-methylcyclopentyl]ethyl]quinolin-2-yl]carbamate.
| Compound Name | butyl N-[7-[2-[(1S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1-methylcyclopentyl]ethyl]quinolin-2-yl]carbamate |
|---|---|
| PubChem CID | 155705411 |
| Molecular Formula | C28H34N6O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | butyl N-[7-[2-[(1S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1-methylcyclopentyl]ethyl]quinolin-2-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc2ccc(CC[C@]3(C)CCC(c4ccc5c(N)ncnn45)C3)cc2n1 |
| InChI | InChI=1S/C28H34N6O2/c1-3-4-15-36-27(35)33-25-10-7-20-6-5-19(16-22(20)32-25)11-13-28(2)14-12-21(17-28)23-8-9-24-26(29)30-18-31-34(23)24/h5-10,16,18,21H,3-4,11-15,17H2,1-2H3,(H2,29,30,31)(H,32,33,35)/t21?,28-/m1/s1 |
| InChIKey | KNXOOAQZUKOWFS-ZSTWXAJCSA-N |
| XLogP | 6.11 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|