C22H22ClFN6O3 — CID 155705439
(1R,2S,3S,4R)-1-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1,2,3-triol (PubChem CID 155705439) has the molecular formula C22H22ClFN6O3 and a molecular weight of 472.91 g/mol. Its IUPAC name is (1R,2S,3S,4R)-1-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1,2,3-triol.
| Compound Name | (1R,2S,3S,4R)-1-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 155705439 |
| Molecular Formula | C22H22ClFN6O3 |
| Molecular Weight | 472.91 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (1R,2S,3S,4R)-1-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1,2,3-triol |
| SMILES | Nc1nc2cc(CC[C@@]3(O)C[C@@H](n4ccc5c(N)ncnc54)[C@H](O)[C@@H]3O)cc(F)c2cc1Cl |
| InChI | InChI=1S/C22H22ClFN6O3/c23-13-7-12-14(24)5-10(6-15(12)29-20(13)26)1-3-22(33)8-16(17(31)18(22)32)30-4-2-11-19(25)27-9-28-21(11)30/h2,4-7,9,16-18,31-33H,1,3,8H2,(H2,26,29)(H2,25,27,28)/t16-,17+,18+,22-/m1/s1 |
| InChIKey | FZDOLFCBBNPRMZ-BZDHPDOMSA-N |
| XLogP | 1.97 |
| TPSA | 156.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.91 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |