C24H26ClFN6O3 — CID 155705467
(1S,2R,3S,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-(methoxymethyl)cyclopentane-1,2-diol (PubChem CID 155705467) has the molecular formula C24H26ClFN6O3 and a molecular weight of 500.96 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-(methoxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-(methoxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 155705467 |
| Molecular Formula | C24H26ClFN6O3 |
| Molecular Weight | 500.96 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (1S,2R,3S,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-(methoxymethyl)cyclopentane-1,2-diol |
| SMILES | COC[C@]1(CCc2cc(F)c3cc(Cl)c(N)nc3c2)C[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H26ClFN6O3/c1-35-10-24(4-2-12-6-16(26)14-8-15(25)22(28)31-17(14)7-12)9-18(19(33)20(24)34)32-5-3-13-21(27)29-11-30-23(13)32/h3,5-8,11,18-20,33-34H,2,4,9-10H2,1H3,(H2,28,31)(H2,27,29,30)/t18-,19+,20+,24+/m1/s1 |
| InChIKey | BKGRZYFOJABSFK-XUJKJYMVSA-N |
| XLogP | 2.87 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.96 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |