About (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene
(Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene (PubChem CID 155705888) has the molecular formula C15H27N3
and a molecular weight of 249.40 g/mol. Its IUPAC name is (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene.
Molecular Properties
| Compound Name | (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene |
| PubChem CID | 155705888 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene |
| SMILES | C/C=C(/C=C/N(C)C)C(\N)=N\C1CCCC1.C=C |
| InChI | InChI=1S/C13H23N3.C2H4/c1-4-11(9-10-16(2)3)13(14)15-12-7-5-6-8-12;1-2/h4,9-10,12H,5-8H2,1-3H3,(H2,14,15);1-2H2/b10-9+,11-4-; |
| InChIKey | KNLZCUVOXKALFL-LJFNVFEDSA-N |
| XLogP | 3.11 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene?
The IUPAC name of (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene (CID 155705888) is (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene.
What is the SMILES notation for (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene?
The canonical SMILES for (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene is C/C=C(/C=C/N(C)C)C(\N)=N\C1CCCC1.C=C.
What is the InChIKey of (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene?
The InChIKey is KNLZCUVOXKALFL-LJFNVFEDSA-N. The full InChI is InChI=1S/C13H23N3.C2H4/c1-4-11(9-10-16(2)3)13(14)15-12-7-5-6-8-12;1-2/h4,9-10,12H,5-8H2,1-3H3,(H2,14,15);1-2H2/b10-9+,11-4-;.
What are the key properties of (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene?
(Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene has a molecular weight of 249.40 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-cyclopentyl-2-[(E)-2-(dimethylamino)ethenyl]but-2-enimidamide;ethene is sourced from PubChem (CID 155705888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).