About 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one
6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one (PubChem CID 15570594) has the molecular formula C22H16ClNO2
and a molecular weight of 361.83 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one.
Molecular Properties
| Compound Name | 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one |
| PubChem CID | 15570594 |
| Molecular Formula | C22H16ClNO2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one |
| SMILES | O=C1C=C(c2ccc(Cl)cc2)OC(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H16ClNO2/c23-18-13-11-16(12-14-18)20-15-21(25)24(19-9-5-2-6-10-19)22(26-20)17-7-3-1-4-8-17/h1-15,22H |
| InChIKey | UDEYBJVXXKLCIC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one?
The IUPAC name of 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one (CID 15570594) is 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one.
What is the SMILES notation for 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one?
The canonical SMILES for 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one is O=C1C=C(c2ccc(Cl)cc2)OC(c2ccccc2)N1c1ccccc1.
What is the InChIKey of 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one?
The InChIKey is UDEYBJVXXKLCIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16ClNO2/c23-18-13-11-16(12-14-18)20-15-21(25)24(19-9-5-2-6-10-19)22(26-20)17-7-3-1-4-8-17/h1-15,22H.
What are the key properties of 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one?
6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one has a molecular weight of 361.83 g/mol, XLogP of 5.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenyl)-2,3-diphenyl-2H-1,3-oxazin-4-one is sourced from PubChem (CID 15570594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).