C15H19ClO3 — CID 155706303
4-[(4-chloro-2-methylphenyl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 155706303) has the molecular formula C15H19ClO3 and a molecular weight of 282.77 g/mol. Its IUPAC name is 4-[(4-chloro-2-methylphenyl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | 4-[(4-chloro-2-methylphenyl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 155706303 |
| Molecular Formula | C15H19ClO3 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-[(4-chloro-2-methylphenyl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | Cc1cc(Cl)ccc1CC1OCC2OC(C)(C)OC12 |
| InChI | InChI=1S/C15H19ClO3/c1-9-6-11(16)5-4-10(9)7-12-14-13(8-17-12)18-15(2,3)19-14/h4-6,12-14H,7-8H2,1-3H3 |
| InChIKey | MYHWALXXUYKGIZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |