C12H16Cl2O4 — CID 155706322
(5S)-5-(3,4-dichlorophenyl)hexane-1,2,3,5-tetrol (PubChem CID 155706322) has the molecular formula C12H16Cl2O4 and a molecular weight of 295.16 g/mol. Its IUPAC name is (5S)-5-(3,4-dichlorophenyl)hexane-1,2,3,5-tetrol.
| Compound Name | (5S)-5-(3,4-dichlorophenyl)hexane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 155706322 |
| Molecular Formula | C12H16Cl2O4 |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | (5S)-5-(3,4-dichlorophenyl)hexane-1,2,3,5-tetrol |
| SMILES | C[C@](O)(CC(O)C(O)CO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2O4/c1-12(18,5-10(16)11(17)6-15)7-2-3-8(13)9(14)4-7/h2-4,10-11,15-18H,5-6H2,1H3/t10?,11?,12-/m0/s1 |
| InChIKey | JXGOGQOAEGLHGB-MCIGGMRASA-N |
| XLogP | 1.31 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |