C9H17NS — CID 15570654
2-ethyl-3,5,6,7,8,8a-hexahydro-2H-[1,3]thiazolo[3,2-a]pyridine (PubChem CID 15570654) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is 2-ethyl-3,5,6,7,8,8a-hexahydro-2H-[1,3]thiazolo[3,2-a]pyridine.
| Compound Name | 2-ethyl-3,5,6,7,8,8a-hexahydro-2H-[1,3]thiazolo[3,2-a]pyridine |
|---|---|
| PubChem CID | 15570654 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2-ethyl-3,5,6,7,8,8a-hexahydro-2H-[1,3]thiazolo[3,2-a]pyridine |
| SMILES | CCC1CN2CCCCC2S1 |
| InChI | InChI=1S/C9H17NS/c1-2-8-7-10-6-4-3-5-9(10)11-8/h8-9H,2-7H2,1H3 |
| InChIKey | QHSRZOOBWOTLDO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |